C39H57NO3 — CID 58785249
2-[4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-hydroxybutyl]isoindole-1,3-dione (PubChem CID 58785249) has the molecular formula C39H57NO3 and a molecular weight of 587.89 g/mol. Its IUPAC name is 2-[4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-hydroxybutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-hydroxybutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58785249 |
| Molecular Formula | C39H57NO3 |
| Molecular Weight | 587.89 g/mol |
| Exact Mass | 587.43 |
| IUPAC Name | 2-[4-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-hydroxybutyl]isoindole-1,3-dione |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC(O)CN5C(=O)c6ccccc6C5=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C39H57NO3/c1-25(2)9-8-10-26(3)33-17-18-34-32-16-14-28-23-27(19-21-38(28,4)35(32)20-22-39(33,34)5)13-15-29(41)24-40-36(42)30-11-6-7-12-31(30)37(40)43/h6-7,11-12,14,25-27,29,32-35,41H,8-10,13,15-24H2,1-5H3 |
| InChIKey | RAFTZKQWLPNTDO-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.89 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|