C32H54O2 — CID 54000943
5-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentanoic acid (PubChem CID 54000943) has the molecular formula C32H54O2 and a molecular weight of 470.78 g/mol. Its IUPAC name is 5-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentanoic acid.
| Compound Name | 5-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 54000943 |
| Molecular Formula | C32H54O2 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | 5-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]pentanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(CCCCC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H54O2/c1-22(2)9-8-10-23(3)27-15-16-28-26-14-13-25-21-24(11-6-7-12-30(33)34)17-19-31(25,4)29(26)18-20-32(27,28)5/h13,22-24,26-29H,6-12,14-21H2,1-5H3,(H,33,34)/t23-,24?,26?,27-,28?,29?,31+,32-/m1/s1 |
| InChIKey | KLOCVTREFCEALL-RYWBLFLCSA-N |
| XLogP | 9.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|