C45H72O2 — CID 91025151
18-[(10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadeca-9,11,13,15-tetraenoic acid (PubChem CID 91025151) has the molecular formula C45H72O2 and a molecular weight of 645.07 g/mol. Its IUPAC name is 18-[(10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadeca-9,11,13,15-tetraenoic acid.
| Compound Name | 18-[(10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadeca-9,11,13,15-tetraenoic acid |
|---|---|
| PubChem CID | 91025151 |
| Molecular Formula | C45H72O2 |
| Molecular Weight | 645.07 g/mol |
| Exact Mass | 644.55 |
| IUPAC Name | 18-[(10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadeca-9,11,13,15-tetraenoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2C3CC=C4CC(CCC=CC=CC=CC=CCCCCCCCC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C45H72O2/c1-35(2)22-21-23-36(3)40-28-29-41-39-27-26-38-34-37(30-32-44(38,4)42(39)31-33-45(40,41)5)24-19-17-15-13-11-9-7-6-8-10-12-14-16-18-20-25-43(46)47/h6-9,11,13,15,17,26,35-37,39-42H,10,12,14,16,18-25,27-34H2,1-5H3,(H,46,47)/t36-,37?,39?,40-,41-,42?,44+,45-/m1/s1 |
| InChIKey | QXCRIJBTHGKRIZ-CGURLDHSSA-N |
| XLogP | 13.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.07 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|