C47H82O2 — CID 54175115
ethyl 18-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enoate (PubChem CID 54175115) has the molecular formula C47H82O2 and a molecular weight of 679.17 g/mol. Its IUPAC name is ethyl 18-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enoate.
| Compound Name | ethyl 18-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enoate |
|---|---|
| PubChem CID | 54175115 |
| Molecular Formula | C47H82O2 |
| Molecular Weight | 679.17 g/mol |
| Exact Mass | 678.63 |
| IUPAC Name | ethyl 18-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octadec-9-enoate |
| SMILES | CCOC(=O)CCCCCCCC=CCCCCCCCCC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C47H82O2/c1-7-49-45(48)27-22-20-18-16-14-12-10-8-9-11-13-15-17-19-21-26-39-32-34-46(5)40(36-39)28-29-41-43-31-30-42(38(4)25-23-24-37(2)3)47(43,6)35-33-44(41)46/h8,10,28,37-39,41-44H,7,9,11-27,29-36H2,1-6H3/t38-,39?,41?,42-,43?,44?,46+,47-/m1/s1 |
| InChIKey | OXTDHEFRWQBSCF-DXSGUHTISA-N |
| XLogP | 14.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.17 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|