C38H62O4 — CID 123678466
1-O'-[4-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butyl] 1-O-ethyl cyclopropane-1,1-dicarboxylate (PubChem CID 123678466) has the molecular formula C38H62O4 and a molecular weight of 582.91 g/mol. Its IUPAC name is 1-O'-[4-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butyl] 1-O-ethyl cyclopropane-1,1-dicarboxylate.
| Compound Name | 1-O'-[4-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butyl] 1-O-ethyl cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 123678466 |
| Molecular Formula | C38H62O4 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.46 |
| IUPAC Name | 1-O'-[4-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butyl] 1-O-ethyl cyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCCCCC2CC[C@@]3(C)C(=CCC4C3CC[C@@]3(C)C4CC[C@@H]3[C@H](C)CCCC(C)C)C2)CC1 |
| InChI | InChI=1S/C38H62O4/c1-7-41-34(39)38(22-23-38)35(40)42-24-9-8-13-28-18-20-36(5)29(25-28)14-15-30-32-17-16-31(27(4)12-10-11-26(2)3)37(32,6)21-19-33(30)36/h14,26-28,30-33H,7-13,15-25H2,1-6H3/t27-,28?,30?,31-,32?,33?,36+,37-/m1/s1 |
| InChIKey | UZZLYKCSNXCERR-RQLZELOISA-N |
| XLogP | 9.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|