C29H48O2 — CID 22843000
2-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 22843000) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 22843000 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 2-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(CC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H48O2/c1-19(2)7-6-8-20(3)24-11-12-25-23-10-9-22-17-21(18-27(30)31)13-15-28(22,4)26(23)14-16-29(24,25)5/h9,19-21,23-26H,6-8,10-18H2,1-5H3,(H,30,31)/t20-,21?,23?,24-,25?,26?,28+,29-/m1/s1 |
| InChIKey | WODDPVMJNIQUII-LADIMAOFSA-N |
| XLogP | 8.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|