C34H60 — CID 162261831
cyclobutane;(3S,8S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 162261831) has the molecular formula C34H60 and a molecular weight of 468.85 g/mol. Its IUPAC name is cyclobutane;(3S,8S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | cyclobutane;(3S,8S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 162261831 |
| Molecular Formula | C34H60 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.47 |
| IUPAC Name | cyclobutane;(3S,8S,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C1CCC1.CCC[C@H]1CCC2(C)C(=CC[C@@H]3C2CCC2(C)C([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H52.C4H8/c1-7-9-23-16-18-29(5)24(20-23)12-13-25-27-15-14-26(22(4)11-8-10-21(2)3)30(27,6)19-17-28(25)29;1-2-4-3-1/h12,21-23,25-28H,7-11,13-20H2,1-6H3;1-4H2/t22-,23+,25+,26?,27+,28?,29?,30?;/m1./s1 |
| InChIKey | ZZIVWVJVTTWYJG-BBDNJBNRSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|