C31H54 — CID 145189649
(10R,17R)-10,13-dimethyl-17-[(3R)-7-methyloctan-3-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 145189649) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is (10R,17R)-10,13-dimethyl-17-[(3R)-7-methyloctan-3-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (10R,17R)-10,13-dimethyl-17-[(3R)-7-methyloctan-3-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145189649 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | (10R,17R)-10,13-dimethyl-17-[(3R)-7-methyloctan-3-yl]-3-propyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCC1CC[C@@]2(C)C(=CCC3C4CC[C@H]([C@H](CC)CCCC(C)C)C4(C)CCC32)C1 |
| InChI | InChI=1S/C31H54/c1-7-10-23-17-19-30(5)25(21-23)13-14-26-28-16-15-27(31(28,6)20-18-29(26)30)24(8-2)12-9-11-22(3)4/h13,22-24,26-29H,7-12,14-21H2,1-6H3/t23?,24-,26?,27-,28?,29?,30+,31?/m1/s1 |
| InChIKey | UOXXBGHQMSVBEH-FRKRCURCSA-N |
| XLogP | 9.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|