C31H54O — CID 134881011
1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropan-2-ol (PubChem CID 134881011) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 134881011 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](CC(C)(C)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H54O/c1-21(2)9-8-10-22(3)26-13-14-27-25-12-11-24-19-23(20-29(4,5)32)15-17-30(24,6)28(25)16-18-31(26,27)7/h11,21-23,25-28,32H,8-10,12-20H2,1-7H3/t22-,23+,25+,26-,27+,28+,30+,31-/m1/s1 |
| InChIKey | KMWDQQXYZFLPGQ-SZXZGTCESA-N |
| XLogP | 8.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|