C36H56 — CID 134943583
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(3-phenylpropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 134943583) has the molecular formula C36H56 and a molecular weight of 488.84 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(3-phenylpropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(3-phenylpropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 134943583 |
| Molecular Formula | C36H56 |
| Molecular Weight | 488.84 g/mol |
| Exact Mass | 488.44 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(3-phenylpropyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(CCCc5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H56/c1-26(2)11-9-12-27(3)32-19-20-33-31-18-17-30-25-29(16-10-15-28-13-7-6-8-14-28)21-23-35(30,4)34(31)22-24-36(32,33)5/h6-8,13-14,17,26-27,29,31-34H,9-12,15-16,18-25H2,1-5H3/t27-,29?,31+,32-,33+,34+,35+,36-/m1/s1 |
| InChIKey | DTCCRYDXQJQTJX-QKYKUEQRSA-N |
| XLogP | 10.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.84 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|