C39H55P — CID 100958143
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-diphenylphosphane (PubChem CID 100958143) has the molecular formula C39H55P and a molecular weight of 554.84 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-diphenylphosphane.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 100958143 |
| Molecular Formula | C39H55P |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-diphenylphosphane |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](P(c5ccccc5)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C39H55P/c1-28(2)13-12-14-29(3)35-21-22-36-34-20-19-30-27-33(23-25-38(30,4)37(34)24-26-39(35,36)5)40(31-15-8-6-9-16-31)32-17-10-7-11-18-32/h6-11,15-19,28-29,33-37H,12-14,20-27H2,1-5H3/t29-,33-,34+,35-,36+,37+,38+,39-/m1/s1 |
| InChIKey | YGRLAKVPBVKCMO-RBLDAARPSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|