C37H64 — CID 143562521
3-[(E)-5-ethyloct-3-enyl]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 143562521) has the molecular formula C37H64 and a molecular weight of 508.92 g/mol. Its IUPAC name is 3-[(E)-5-ethyloct-3-enyl]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 3-[(E)-5-ethyloct-3-enyl]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143562521 |
| Molecular Formula | C37H64 |
| Molecular Weight | 508.92 g/mol |
| Exact Mass | 508.50 |
| IUPAC Name | 3-[(E)-5-ethyloct-3-enyl]-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCC(/C=C/CCC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1)CC |
| InChI | InChI=1S/C37H64/c1-8-13-29(9-2)16-10-11-17-30-22-24-36(6)31(26-30)18-19-32-34-21-20-33(28(5)15-12-14-27(3)4)37(34,7)25-23-35(32)36/h10,16,18,27-30,32-35H,8-9,11-15,17,19-26H2,1-7H3/b16-10+ |
| InChIKey | IKIHXMCMBWTDKJ-MHWRWJLKSA-N |
| XLogP | 11.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.92 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|