C31H52N2O2 — CID 101103110
N'-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butanediamide (PubChem CID 101103110) has the molecular formula C31H52N2O2 and a molecular weight of 484.77 g/mol. Its IUPAC name is N'-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butanediamide.
| Compound Name | N'-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butanediamide |
|---|---|
| PubChem CID | 101103110 |
| Molecular Formula | C31H52N2O2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.40 |
| IUPAC Name | N'-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]butanediamide |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](NC(=O)CCC(N)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52N2O2/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(33-29(35)14-13-28(32)34)15-17-30(22,4)27(24)16-18-31(25,26)5/h9,20-21,23-27H,6-8,10-19H2,1-5H3,(H2,32,34)(H,33,35)/t21-,23-,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | VFOSGNHZDXSFFV-OGIUOUPUSA-N |
| XLogP | 6.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|