C39H65NO3 — CID 163741789
[(10R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(cyclooctylamino)-4-oxobutanoate (PubChem CID 163741789) has the molecular formula C39H65NO3 and a molecular weight of 595.95 g/mol. Its IUPAC name is [(10R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(cyclooctylamino)-4-oxobutanoate.
| Compound Name | [(10R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(cyclooctylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 163741789 |
| Molecular Formula | C39H65NO3 |
| Molecular Weight | 595.95 g/mol |
| Exact Mass | 595.50 |
| IUPAC Name | [(10R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(cyclooctylamino)-4-oxobutanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCC(=O)NC5CCCCCCC5)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C39H65NO3/c1-27(2)12-11-13-28(3)33-18-19-34-32-17-16-29-26-31(22-24-38(29,4)35(32)23-25-39(33,34)5)43-37(42)21-20-36(41)40-30-14-9-7-6-8-10-15-30/h16,27-28,30-35H,6-15,17-26H2,1-5H3,(H,40,41)/t28?,31?,32?,33?,34?,35?,38-,39?/m0/s1 |
| InChIKey | LIKBJRMKQCNESR-QGQRJIMASA-N |
| XLogP | 9.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.95 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|