C30H52N2O — CID 167103890
3-amino-N-[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]propanamide (PubChem CID 167103890) has the molecular formula C30H52N2O and a molecular weight of 456.76 g/mol. Its IUPAC name is 3-amino-N-[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]propanamide.
| Compound Name | 3-amino-N-[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]propanamide |
|---|---|
| PubChem CID | 167103890 |
| Molecular Formula | C30H52N2O |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.41 |
| IUPAC Name | 3-amino-N-[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]propanamide |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](NC(=O)CCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H52N2O/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(32-28(33)15-18-31)13-16-29(22,4)27(24)14-17-30(25,26)5/h9,20-21,23-27H,6-8,10-19,31H2,1-5H3,(H,32,33)/t21-,23+,24?,25-,26?,27?,29+,30-/m1/s1 |
| InChIKey | NSZWCZOTUVVLOF-TUNRYDLISA-N |
| XLogP | 6.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|