C34H52N2O2 — CID 67571382
1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-(4-hydroxyphenyl)urea (PubChem CID 67571382) has the molecular formula C34H52N2O2 and a molecular weight of 520.80 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 67571382 |
| Molecular Formula | C34H52N2O2 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.40 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-3-(4-hydroxyphenyl)urea |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](NC(=O)Nc5ccc(O)cc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H52N2O2/c1-22(2)7-6-8-23(3)29-15-16-30-28-14-9-24-21-26(36-32(38)35-25-10-12-27(37)13-11-25)17-19-33(24,4)31(28)18-20-34(29,30)5/h9-13,22-23,26,28-31,37H,6-8,14-21H2,1-5H3,(H2,35,36,38)/t23-,26+,28+,29-,30+,31+,33+,34-/m1/s1 |
| InChIKey | WBTNODNXSPZQEP-WCECHVPBSA-N |
| XLogP | 8.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|