C11H13N3O — CID 13398166
2-amino-3-benzyl-4,5-dihydropyrimidin-6-one (PubChem CID 13398166) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-amino-3-benzyl-4,5-dihydropyrimidin-6-one.
| Compound Name | 2-amino-3-benzyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 13398166 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-amino-3-benzyl-4,5-dihydropyrimidin-6-one |
| SMILES | NC1=NC(=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c12-11-13-10(15)6-7-14(11)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,13,15) |
| InChIKey | MWRIIDRMBLQTMZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |