C16H17N3O — CID 10587904
4-benzyl-1-phenyl-1,2,4-triazinan-3-one (PubChem CID 10587904) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-benzyl-1-phenyl-1,2,4-triazinan-3-one.
| Compound Name | 4-benzyl-1-phenyl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 10587904 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-benzyl-1-phenyl-1,2,4-triazinan-3-one |
| SMILES | O=C1NN(c2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H17N3O/c20-16-17-19(15-9-5-2-6-10-15)12-11-18(16)13-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,17,20) |
| InChIKey | MHOWFJQDAGLHOJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |