C42H50N6O4 — CID 10676220
1,7,10,16-tetrabenzyl-4,13-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,6,11,15-tetrone (PubChem CID 10676220) has the molecular formula C42H50N6O4 and a molecular weight of 702.90 g/mol. Its IUPAC name is 1,7,10,16-tetrabenzyl-4,13-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,6,11,15-tetrone.
| Compound Name | 1,7,10,16-tetrabenzyl-4,13-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,6,11,15-tetrone |
|---|---|
| PubChem CID | 10676220 |
| Molecular Formula | C42H50N6O4 |
| Molecular Weight | 702.90 g/mol |
| Exact Mass | 702.39 |
| IUPAC Name | 1,7,10,16-tetrabenzyl-4,13-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,6,11,15-tetrone |
| SMILES | CN1CC(=O)N(Cc2ccccc2)CCN(Cc2ccccc2)C(=O)CN(C)CC(=O)N(Cc2ccccc2)CCN(Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C42H50N6O4/c1-43-31-39(49)45(27-35-15-7-3-8-16-35)23-25-47(29-37-19-11-5-12-20-37)41(51)33-44(2)34-42(52)48(30-38-21-13-6-14-22-38)26-24-46(40(50)32-43)28-36-17-9-4-10-18-36/h3-22H,23-34H2,1-2H3 |
| InChIKey | PYNLRNXVVDDJTG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |