C13H17ClN2O3 — CID 142651914
4-[(4-methyl-2-oxopiperazin-1-yl)methyl]benzoic acid;hydrochloride (PubChem CID 142651914) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-[(4-methyl-2-oxopiperazin-1-yl)methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[(4-methyl-2-oxopiperazin-1-yl)methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 142651914 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-[(4-methyl-2-oxopiperazin-1-yl)methyl]benzoic acid;hydrochloride |
| SMILES | CN1CCN(Cc2ccc(C(=O)O)cc2)C(=O)C1.Cl |
| InChI | InChI=1S/C13H16N2O3.ClH/c1-14-6-7-15(12(16)9-14)8-10-2-4-11(5-3-10)13(17)18;/h2-5H,6-9H2,1H3,(H,17,18);1H |
| InChIKey | SQZNCWNKQIUPGN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |