4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid

C15H22N2O2 — CID 122029124

IUPAC4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid
SMILESCN1CCN(Cc2ccc(C(=O)O)cc2)C(C)(C)C1
InChIInChI=1S/C15H22N2O2/c1-15(2)11-16(3)8-9-17(15)10-12-4-6-13(7-5-12)14(18)19/h4-7H,8-11H2,1-3H3,(H,18,19)
InChIKeyIKGNOHIAGBVCLQ-UHFFFAOYSA-N
MW262.35 g/mol
LogP1.91
Rot. Bonds3

About 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid

4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid (PubChem CID 122029124) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid
PubChem CID122029124
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid
SMILESCN1CCN(Cc2ccc(C(=O)O)cc2)C(C)(C)C1
InChIInChI=1S/C15H22N2O2/c1-15(2)11-16(3)8-9-17(15)10-12-4-6-13(7-5-12)14(18)19/h4-7H,8-11H2,1-3H3,(H,18,19)
InChIKeyIKGNOHIAGBVCLQ-UHFFFAOYSA-N
XLogP1.91
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid?
The IUPAC name of 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid (CID 122029124) is 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid.
What is the SMILES notation for 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid?
The canonical SMILES for 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid is CN1CCN(Cc2ccc(C(=O)O)cc2)C(C)(C)C1.
What is the InChIKey of 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid?
The InChIKey is IKGNOHIAGBVCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-15(2)11-16(3)8-9-17(15)10-12-4-6-13(7-5-12)14(18)19/h4-7H,8-11H2,1-3H3,(H,18,19).
What are the key properties of 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid?
4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid has a molecular weight of 262.35 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2,4-trimethylpiperazin-1-yl)methyl]benzoic acid is sourced from PubChem (CID 122029124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).