C15H24N2O2 — CID 143662062
ethane;4-[(4-methylpiperazin-1-yl)methyl]benzoic acid (PubChem CID 143662062) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;4-[(4-methylpiperazin-1-yl)methyl]benzoic acid.
| Compound Name | ethane;4-[(4-methylpiperazin-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 143662062 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethane;4-[(4-methylpiperazin-1-yl)methyl]benzoic acid |
| SMILES | CC.CN1CCN(Cc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C13H18N2O2.C2H6/c1-14-6-8-15(9-7-14)10-11-2-4-12(5-3-11)13(16)17;1-2/h2-5H,6-10H2,1H3,(H,16,17);1-2H3 |
| InChIKey | CQFJZIPRNSAJPS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |