C16H16N2O — CID 91757247
3-benzyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one (PubChem CID 91757247) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-benzyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one.
| Compound Name | 3-benzyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 91757247 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-benzyl-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccccc2CCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c19-16-17-15-9-5-4-8-14(15)10-11-18(16)12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,17,19) |
| InChIKey | YYUJZSIPSOLVRE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |