C17H17NO — CID 115107236
1-(1-benzyl-2,3-dihydroindol-7-yl)ethanone (PubChem CID 115107236) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(1-benzyl-2,3-dihydroindol-7-yl)ethanone.
| Compound Name | 1-(1-benzyl-2,3-dihydroindol-7-yl)ethanone |
|---|---|
| PubChem CID | 115107236 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(1-benzyl-2,3-dihydroindol-7-yl)ethanone |
| SMILES | CC(=O)c1cccc2c1N(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C17H17NO/c1-13(19)16-9-5-8-15-10-11-18(17(15)16)12-14-6-3-2-4-7-14/h2-9H,10-12H2,1H3 |
| InChIKey | YDOAOEODMDIVKZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |