C19H17NO — CID 102461664
1-benzyl-3,9-dihydro-2H-indeno[2,1-b]pyridin-4-one (PubChem CID 102461664) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-benzyl-3,9-dihydro-2H-indeno[2,1-b]pyridin-4-one.
| Compound Name | 1-benzyl-3,9-dihydro-2H-indeno[2,1-b]pyridin-4-one |
|---|---|
| PubChem CID | 102461664 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-benzyl-3,9-dihydro-2H-indeno[2,1-b]pyridin-4-one |
| SMILES | O=C1CCN(Cc2ccccc2)C2=C1c1ccccc1C2 |
| InChI | InChI=1S/C19H17NO/c21-18-10-11-20(13-14-6-2-1-3-7-14)17-12-15-8-4-5-9-16(15)19(17)18/h1-9H,10-13H2 |
| InChIKey | NREYAOQIPHKYTQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_B(4)', 'substructure': 'N/A'} |
|---|