C16H12O2 — CID 163817575
tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaene-2,11-dione (PubChem CID 163817575) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaene-2,11-dione.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaene-2,11-dione |
|---|---|
| PubChem CID | 163817575 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaene-2,11-dione |
| SMILES | O=C1Cc2ccccc2CC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H12O2/c17-15-9-11-5-1-2-6-12(11)10-16(18)14-8-4-3-7-13(14)15/h1-8H,9-10H2 |
| InChIKey | NSQBEEQBIJATFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |