About 10H-phenanthren-9-one;phosphoryl trichloride
10H-phenanthren-9-one;phosphoryl trichloride (PubChem CID 123741293) has the molecular formula C14H10Cl3O2P
and a molecular weight of 347.56 g/mol. Its IUPAC name is 10H-phenanthren-9-one;phosphoryl trichloride.
Molecular Properties
| Compound Name | 10H-phenanthren-9-one;phosphoryl trichloride |
| PubChem CID | 123741293 |
| Molecular Formula | C14H10Cl3O2P |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 10H-phenanthren-9-one;phosphoryl trichloride |
| SMILES | O=C1Cc2ccccc2-c2ccccc21.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H10O.Cl3OP/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14;1-5(2,3)4/h1-8H,9H2; |
| InChIKey | CALFEXAGPSGHQK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenanthren-9-one;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenanthren-9-one;phosphoryl trichloride?
The IUPAC name of 10H-phenanthren-9-one;phosphoryl trichloride (CID 123741293) is 10H-phenanthren-9-one;phosphoryl trichloride.
What is the SMILES notation for 10H-phenanthren-9-one;phosphoryl trichloride?
The canonical SMILES for 10H-phenanthren-9-one;phosphoryl trichloride is O=C1Cc2ccccc2-c2ccccc21.O=P(Cl)(Cl)Cl.
What is the InChIKey of 10H-phenanthren-9-one;phosphoryl trichloride?
The InChIKey is CALFEXAGPSGHQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O.Cl3OP/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14;1-5(2,3)4/h1-8H,9H2;.
What are the key properties of 10H-phenanthren-9-one;phosphoryl trichloride?
10H-phenanthren-9-one;phosphoryl trichloride has a molecular weight of 347.56 g/mol, XLogP of 5.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenanthren-9-one;phosphoryl trichloride is sourced from PubChem (CID 123741293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).