C16H11BrO2 — CID 145241657
14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-2,11-dione (PubChem CID 145241657) has the molecular formula C16H11BrO2 and a molecular weight of 315.17 g/mol. Its IUPAC name is 14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-2,11-dione.
| Compound Name | 14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-2,11-dione |
|---|---|
| PubChem CID | 145241657 |
| Molecular Formula | C16H11BrO2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 14-bromotricyclo[10.4.0.04,9]hexadeca-1(12),4,6,8,13,15-hexaene-2,11-dione |
| SMILES | O=C1Cc2ccccc2CC(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C16H11BrO2/c17-12-5-6-13-14(9-12)16(19)8-11-4-2-1-3-10(11)7-15(13)18/h1-6,9H,7-8H2 |
| InChIKey | BBHCRXHSPHEXHW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |