C24H20Br2O4 — CID 158711317
5-bromo-2-cyclohexylindene-1,3-dione;5-bromoindene-1,3-dione (PubChem CID 158711317) has the molecular formula C24H20Br2O4 and a molecular weight of 532.23 g/mol. Its IUPAC name is 5-bromo-2-cyclohexylindene-1,3-dione;5-bromoindene-1,3-dione.
| Compound Name | 5-bromo-2-cyclohexylindene-1,3-dione;5-bromoindene-1,3-dione |
|---|---|
| PubChem CID | 158711317 |
| Molecular Formula | C24H20Br2O4 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | 5-bromo-2-cyclohexylindene-1,3-dione;5-bromoindene-1,3-dione |
| SMILES | O=C1CC(=O)c2cc(Br)ccc21.O=C1c2ccc(Br)cc2C(=O)C1C1CCCCC1 |
| InChI | InChI=1S/C15H15BrO2.C9H5BrO2/c16-10-6-7-11-12(8-10)15(18)13(14(11)17)9-4-2-1-3-5-9;10-5-1-2-6-7(3-5)9(12)4-8(6)11/h6-9,13H,1-5H2;1-3H,4H2 |
| InChIKey | IITHWWJJYAQJGU-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|