C10H9BrO2 — CID 93493266
(2R)-6-bromo-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 93493266) has the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. Its IUPAC name is (2R)-6-bromo-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2R)-6-bromo-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 93493266 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | (2R)-6-bromo-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccc(Br)cc2CC[C@H]1O |
| InChI | InChI=1S/C10H9BrO2/c11-7-2-3-8-6(5-7)1-4-9(12)10(8)13/h2-3,5,9,12H,1,4H2/t9-/m1/s1 |
| InChIKey | CTUWDHRJTDLLHR-SECBINFHSA-N |
| XLogP | 1.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |