C10H11BrO — CID 105484321
7-bromo-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 105484321) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 7-bromo-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 105484321 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | OC1CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H11BrO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1,3,5,10,12H,2,4,6H2 |
| InChIKey | UGQHSPTYEKKEJS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |