C11H13BrO — CID 147048026
(2S,3S)-6-bromo-3-methyl-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 147048026) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is (2S,3S)-6-bromo-3-methyl-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S,3S)-6-bromo-3-methyl-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 147048026 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (2S,3S)-6-bromo-3-methyl-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | C[C@H]1Cc2cc(Br)ccc2C[C@@H]1O |
| InChI | InChI=1S/C11H13BrO/c1-7-4-9-5-10(12)3-2-8(9)6-11(7)13/h2-3,5,7,11,13H,4,6H2,1H3/t7-,11-/m0/s1 |
| InChIKey | BATJMYORJUJOFG-CPCISQLKSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |