C12H15Br — CID 162045632
6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 162045632) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 162045632 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-bromo-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1Cc2ccc(Br)cc2CC1C |
| InChI | InChI=1S/C12H15Br/c1-8-5-10-3-4-12(13)7-11(10)6-9(8)2/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | LLSVGDDKVGPWNH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |