C10H10BrCl — CID 79725428
6-bromo-1-chloro-2-methyl-2,3-dihydro-1H-indene (PubChem CID 79725428) has the molecular formula C10H10BrCl and a molecular weight of 245.55 g/mol. Its IUPAC name is 6-bromo-1-chloro-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 6-bromo-1-chloro-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 79725428 |
| Molecular Formula | C10H10BrCl |
| Molecular Weight | 245.55 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 6-bromo-1-chloro-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2ccc(Br)cc2C1Cl |
| InChI | InChI=1S/C10H10BrCl/c1-6-4-7-2-3-8(11)5-9(7)10(6)12/h2-3,5-6,10H,4H2,1H3 |
| InChIKey | SCQIUZWERKZVEL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|