C17H16Br2 — CID 163273815
(8R,10R)-5,13-dibromo-8,10-dimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene (PubChem CID 163273815) has the molecular formula C17H16Br2 and a molecular weight of 380.12 g/mol. Its IUPAC name is (8R,10R)-5,13-dibromo-8,10-dimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene.
| Compound Name | (8R,10R)-5,13-dibromo-8,10-dimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
|---|---|
| PubChem CID | 163273815 |
| Molecular Formula | C17H16Br2 |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | (8R,10R)-5,13-dibromo-8,10-dimethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene |
| SMILES | C[C@@H]1C[C@@H](C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H16Br2/c1-10-7-11(2)17-9-13(19)4-6-15(17)14-5-3-12(18)8-16(10)14/h3-6,8-11H,7H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | KXNLANXNCCOEBK-GHMZBOCLSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |