C10H12BrNO — CID 142041886
5-bromo-1-methoxy-3-methyl-2,3-dihydroindole (PubChem CID 142041886) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 5-bromo-1-methoxy-3-methyl-2,3-dihydroindole.
| Compound Name | 5-bromo-1-methoxy-3-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 142041886 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 5-bromo-1-methoxy-3-methyl-2,3-dihydroindole |
| SMILES | CON1CC(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C10H12BrNO/c1-7-6-12(13-2)10-4-3-8(11)5-9(7)10/h3-5,7H,6H2,1-2H3 |
| InChIKey | RMLQVEPSNHOAER-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |