About 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine
1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine (PubChem CID 117202243) has the molecular formula C12H17BrN2
and a molecular weight of 269.19 g/mol. Its IUPAC name is 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine |
| PubChem CID | 117202243 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine |
| SMILES | CCN1CC(C(C)N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H17BrN2/c1-3-15-7-11(8(2)14)10-6-9(13)4-5-12(10)15/h4-6,8,11H,3,7,14H2,1-2H3 |
| InChIKey | ZXCOWZDBHWWJPC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine?
The IUPAC name of 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine (CID 117202243) is 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine.
What is the SMILES notation for 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine?
The canonical SMILES for 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine is CCN1CC(C(C)N)c2cc(Br)ccc21.
What is the InChIKey of 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine?
The InChIKey is ZXCOWZDBHWWJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2/c1-3-15-7-11(8(2)14)10-6-9(13)4-5-12(10)15/h4-6,8,11H,3,7,14H2,1-2H3.
What are the key properties of 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine?
1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine has a molecular weight of 269.19 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)ethanamine is sourced from PubChem (CID 117202243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).