About 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine
2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine (PubChem CID 117202262) has the molecular formula C13H19BrN2
and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine |
| PubChem CID | 117202262 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine |
| SMILES | CCN1CC(CCNC)c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H19BrN2/c1-3-16-9-10(6-7-15-2)12-8-11(14)4-5-13(12)16/h4-5,8,10,15H,3,6-7,9H2,1-2H3 |
| InChIKey | FCMGDIAAGLDJNT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine?
The IUPAC name of 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine (CID 117202262) is 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine.
What is the SMILES notation for 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine?
The canonical SMILES for 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine is CCN1CC(CCNC)c2cc(Br)ccc21.
What is the InChIKey of 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine?
The InChIKey is FCMGDIAAGLDJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN2/c1-3-16-9-10(6-7-15-2)12-8-11(14)4-5-13(12)16/h4-5,8,10,15H,3,6-7,9H2,1-2H3.
What are the key properties of 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine?
2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine has a molecular weight of 283.21 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1-ethyl-2,3-dihydroindol-3-yl)-N-methylethanamine is sourced from PubChem (CID 117202262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).