C18H12Br2 — CID 23373259
2,7-dibromo-9-cyclopenta-1,4-dien-1-yl-9H-fluorene (PubChem CID 23373259) has the molecular formula C18H12Br2 and a molecular weight of 388.10 g/mol. Its IUPAC name is 2,7-dibromo-9-cyclopenta-1,4-dien-1-yl-9H-fluorene.
| Compound Name | 2,7-dibromo-9-cyclopenta-1,4-dien-1-yl-9H-fluorene |
|---|---|
| PubChem CID | 23373259 |
| Molecular Formula | C18H12Br2 |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 2,7-dibromo-9-cyclopenta-1,4-dien-1-yl-9H-fluorene |
| SMILES | Brc1ccc2c(c1)C(C1=CCC=C1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C18H12Br2/c19-12-5-7-14-15-8-6-13(20)10-17(15)18(16(14)9-12)11-3-1-2-4-11/h1,3-10,18H,2H2 |
| InChIKey | SWGDWXATLARXPH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |