About (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine
(7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine (PubChem CID 162495363) has the molecular formula C12H13BrN4
and a molecular weight of 293.17 g/mol. Its IUPAC name is (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine.
Molecular Properties
| Compound Name | (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine |
| PubChem CID | 162495363 |
| Molecular Formula | C12H13BrN4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine |
| SMILES | Cc1nnn2c1-c1ccc(Br)cc1[C@H](N)CC2 |
| InChI | InChI=1S/C12H13BrN4/c1-7-12-9-3-2-8(13)6-10(9)11(14)4-5-17(12)16-15-7/h2-3,6,11H,4-5,14H2,1H3/t11-/m1/s1 |
| InChIKey | OQXNAYONGQFOMY-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine?
The IUPAC name of (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine (CID 162495363) is (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine.
What is the SMILES notation for (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine?
The canonical SMILES for (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine is Cc1nnn2c1-c1ccc(Br)cc1[C@H](N)CC2.
What is the InChIKey of (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine?
The InChIKey is OQXNAYONGQFOMY-LLVKDONJSA-N. The full InChI is InChI=1S/C12H13BrN4/c1-7-12-9-3-2-8(13)6-10(9)11(14)4-5-17(12)16-15-7/h2-3,6,11H,4-5,14H2,1H3/t11-/m1/s1.
What are the key properties of (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine?
(7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine has a molecular weight of 293.17 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-9-bromo-1-methyl-6,7-dihydro-5H-triazolo[5,1-a][2]benzazepin-7-amine is sourced from PubChem (CID 162495363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).