C11H14BrN — CID 115417625
7-bromo-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115417625) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 7-bromo-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 7-bromo-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115417625 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 7-bromo-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC1CCC(N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H14BrN/c1-7-2-5-11(13)10-6-8(12)3-4-9(7)10/h3-4,6-7,11H,2,5,13H2,1H3 |
| InChIKey | ATKJUUHHHHAFNM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |