C12H17N — CID 155465000
4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 155465000) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 155465000 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Cc1ccc2c(c1)C(C)CCC2N |
| InChI | InChI=1S/C12H17N/c1-8-3-5-10-11(7-8)9(2)4-6-12(10)13/h3,5,7,9,12H,4,6,13H2,1-2H3 |
| InChIKey | AFNJYJIZQYPYKV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |