C28H12Br4O4 — CID 159425513
2,7-dibromophenanthrene-9,10-dione (PubChem CID 159425513) has the molecular formula C28H12Br4O4 and a molecular weight of 732.02 g/mol. Its IUPAC name is 2,7-dibromophenanthrene-9,10-dione.
| Compound Name | 2,7-dibromophenanthrene-9,10-dione |
|---|---|
| PubChem CID | 159425513 |
| Molecular Formula | C28H12Br4O4 |
| Molecular Weight | 732.02 g/mol |
| Exact Mass | 727.75 |
| IUPAC Name | 2,7-dibromophenanthrene-9,10-dione |
| SMILES | O=C1C(=O)c2cc(Br)ccc2-c2ccc(Br)cc21.O=C1C(=O)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/2C14H6Br2O2/c2*15-7-1-3-9-10-4-2-8(16)6-12(10)14(18)13(17)11(9)5-7/h2*1-6H |
| InChIKey | LQHJRHJDEIYLSM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.02 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|