C15H9BrO3 — CID 138963377
2-bromo-6-methoxyanthracene-9,10-dione (PubChem CID 138963377) has the molecular formula C15H9BrO3 and a molecular weight of 317.14 g/mol. Its IUPAC name is 2-bromo-6-methoxyanthracene-9,10-dione.
| Compound Name | 2-bromo-6-methoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 138963377 |
| Molecular Formula | C15H9BrO3 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-bromo-6-methoxyanthracene-9,10-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1ccc(Br)cc1C2=O |
| InChI | InChI=1S/C15H9BrO3/c1-19-9-3-5-11-13(7-9)15(18)10-4-2-8(16)6-12(10)14(11)17/h2-7H,1H3 |
| InChIKey | ASTFTMIYXREUNT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|