About 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione
3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione (PubChem CID 141418126) has the molecular formula C17H10BrNO3
and a molecular weight of 356.18 g/mol. Its IUPAC name is 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione.
Molecular Properties
| Compound Name | 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione |
| PubChem CID | 141418126 |
| Molecular Formula | C17H10BrNO3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2c(=O)[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C17H10BrNO3/c1-22-9-3-5-10-12(7-9)16(20)14-11-4-2-8(18)6-13(11)19-17(21)15(10)14/h2-7H,1H3,(H,19,21) |
| InChIKey | LNLUERSDSCCAJS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione?
The IUPAC name of 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione (CID 141418126) is 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione.
What is the SMILES notation for 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione?
The canonical SMILES for 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione is COc1ccc2c(c1)C(=O)c1c-2c(=O)[nH]c2cc(Br)ccc12.
What is the InChIKey of 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione?
The InChIKey is LNLUERSDSCCAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10BrNO3/c1-22-9-3-5-10-12(7-9)16(20)14-11-4-2-8(18)6-13(11)19-17(21)15(10)14/h2-7H,1H3,(H,19,21).
What are the key properties of 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione?
3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione has a molecular weight of 356.18 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-9-methoxy-5H-indeno[1,2-c]quinoline-6,11-dione is sourced from PubChem (CID 141418126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).