C17H11NO2S — CID 52951043
9-methoxy-6-sulfanylidene-5H-indeno[1,2-c]quinolin-11-one (PubChem CID 52951043) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 9-methoxy-6-sulfanylidene-5H-indeno[1,2-c]quinolin-11-one.
| Compound Name | 9-methoxy-6-sulfanylidene-5H-indeno[1,2-c]quinolin-11-one |
|---|---|
| PubChem CID | 52951043 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 9-methoxy-6-sulfanylidene-5H-indeno[1,2-c]quinolin-11-one |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2c(=S)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H11NO2S/c1-20-9-6-7-10-12(8-9)16(19)14-11-4-2-3-5-13(11)18-17(21)15(10)14/h2-8H,1H3,(H,18,21) |
| InChIKey | CDUNJJROAPPPKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|