C14H8Br2O2 — CID 175173621
2,7-dibromo-4-methoxyfluoren-9-one (PubChem CID 175173621) has the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. Its IUPAC name is 2,7-dibromo-4-methoxyfluoren-9-one.
| Compound Name | 2,7-dibromo-4-methoxyfluoren-9-one |
|---|---|
| PubChem CID | 175173621 |
| Molecular Formula | C14H8Br2O2 |
| Molecular Weight | 368.02 g/mol |
| Exact Mass | 365.89 |
| IUPAC Name | 2,7-dibromo-4-methoxyfluoren-9-one |
| SMILES | COc1cc(Br)cc2c1-c1ccc(Br)cc1C2=O |
| InChI | InChI=1S/C14H8Br2O2/c1-18-12-6-8(16)5-11-13(12)9-3-2-7(15)4-10(9)14(11)17/h2-6H,1H3 |
| InChIKey | YQBAOJQDQUZKFR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |