About 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one
5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one (PubChem CID 126632998) has the molecular formula C22H14Br2O
and a molecular weight of 454.16 g/mol. Its IUPAC name is 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one.
Molecular Properties
| Compound Name | 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one |
| PubChem CID | 126632998 |
| Molecular Formula | C22H14Br2O |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one |
| SMILES | CC1(C)c2ccccc2-c2c(Br)cc3c(c21)-c1ccc(Br)cc1C3=O |
| InChI | InChI=1S/C22H14Br2O/c1-22(2)16-6-4-3-5-13(16)19-17(24)10-15-18(20(19)22)12-8-7-11(23)9-14(12)21(15)25/h3-10H,1-2H3 |
| InChIKey | HFCVKGBBZVLJRR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one?
The IUPAC name of 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one (CID 126632998) is 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one.
What is the SMILES notation for 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one?
The canonical SMILES for 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one is CC1(C)c2ccccc2-c2c(Br)cc3c(c21)-c1ccc(Br)cc1C3=O.
What is the InChIKey of 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one?
The InChIKey is HFCVKGBBZVLJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Br2O/c1-22(2)16-6-4-3-5-13(16)19-17(24)10-15-18(20(19)22)12-8-7-11(23)9-14(12)21(15)25/h3-10H,1-2H3.
What are the key properties of 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one?
5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one has a molecular weight of 454.16 g/mol, XLogP of 6.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dibromo-12,12-dimethylindeno[1,2-a]fluoren-7-one is sourced from PubChem (CID 126632998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).