About 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one
5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one (PubChem CID 126632985) has the molecular formula C19H8Br2OS
and a molecular weight of 444.15 g/mol. Its IUPAC name is 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one.
Molecular Properties
| Compound Name | 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one |
| PubChem CID | 126632985 |
| Molecular Formula | C19H8Br2OS |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 441.87 |
| IUPAC Name | 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one |
| SMILES | O=C1c2cc(Br)ccc2-c2c1cc(Br)c1c2sc2ccccc21 |
| InChI | InChI=1S/C19H8Br2OS/c20-9-5-6-10-12(7-9)18(22)13-8-14(21)17-11-3-1-2-4-15(11)23-19(17)16(10)13/h1-8H |
| InChIKey | BDVCISZATZQRNB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one?
The IUPAC name of 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one (CID 126632985) is 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one.
What is the SMILES notation for 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one?
The canonical SMILES for 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one is O=C1c2cc(Br)ccc2-c2c1cc(Br)c1c2sc2ccccc21.
What is the InChIKey of 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one?
The InChIKey is BDVCISZATZQRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H8Br2OS/c20-9-5-6-10-12(7-9)18(22)13-8-14(21)17-11-3-1-2-4-15(11)23-19(17)16(10)13/h1-8H.
What are the key properties of 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one?
5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one has a molecular weight of 444.15 g/mol, XLogP of 6.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dibromofluoreno[4,3-b][1]benzothiol-7-one is sourced from PubChem (CID 126632985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).