About CID 149438986
CID 149438986 (PubChem CID 149438986) has the molecular formula C19H9BOS
and a molecular weight of 296.16 g/mol.
Molecular Properties
| Compound Name | CID 149438986 |
| PubChem CID | 149438986 |
| Molecular Formula | C19H9BOS |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(=O)c1ccc3c(sc4ccccc43)c1-2 |
| InChI | InChI=1S/C19H9BOS/c20-10-5-6-12-15(9-10)18(21)14-8-7-13-11-3-1-2-4-16(11)22-19(13)17(12)14/h1-9H |
| InChIKey | SSFXXQDVSYLBBF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 149438986 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149438986?
The IUPAC name of CID 149438986 (CID 149438986) is not available.
What is the SMILES notation for CID 149438986?
The canonical SMILES for CID 149438986 is [B]c1ccc2c(c1)C(=O)c1ccc3c(sc4ccccc43)c1-2.
What is the InChIKey of CID 149438986?
The InChIKey is SSFXXQDVSYLBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H9BOS/c20-10-5-6-12-15(9-10)18(21)14-8-7-13-11-3-1-2-4-16(11)22-19(13)17(12)14/h1-9H.
What are the key properties of CID 149438986?
CID 149438986 has a molecular weight of 296.16 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149438986 is sourced from PubChem (CID 149438986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).